C22H41BO4 — CID 134886770
ethyl 2-[(4R)-6-[(E)-2-[bis(3-methylbutan-2-yl)boranyl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 134886770) has the molecular formula C22H41BO4 and a molecular weight of 380.38 g/mol. Its IUPAC name is ethyl 2-[(4R)-6-[(E)-2-[bis(3-methylbutan-2-yl)boranyl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | ethyl 2-[(4R)-6-[(E)-2-[bis(3-methylbutan-2-yl)boranyl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 134886770 |
| Molecular Formula | C22H41BO4 |
| Molecular Weight | 380.38 g/mol |
| Exact Mass | 380.31 |
| IUPAC Name | ethyl 2-[(4R)-6-[(E)-2-[bis(3-methylbutan-2-yl)boranyl]ethenyl]-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CC(/C=C/B(C(C)C(C)C)C(C)C(C)C)OC(C)(C)O1 |
| InChI | InChI=1S/C22H41BO4/c1-10-25-21(24)14-20-13-19(26-22(8,9)27-20)11-12-23(17(6)15(2)3)18(7)16(4)5/h11-12,15-20H,10,13-14H2,1-9H3/b12-11+/t17?,18?,19?,20-/m1/s1 |
| InChIKey | BQYDIWRAWJTIND-QZOWRNSSSA-N |
| XLogP | 5.53 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.38 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|