C9H14O4 — CID 138980614
methyl 2-[(4R,6S)-6-ethenyl-1,3-dioxan-4-yl]acetate (PubChem CID 138980614) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is methyl 2-[(4R,6S)-6-ethenyl-1,3-dioxan-4-yl]acetate.
| Compound Name | methyl 2-[(4R,6S)-6-ethenyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 138980614 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | methyl 2-[(4R,6S)-6-ethenyl-1,3-dioxan-4-yl]acetate |
| SMILES | C=C[C@@H]1C[C@H](CC(=O)OC)OCO1 |
| InChI | InChI=1S/C9H14O4/c1-3-7-4-8(13-6-12-7)5-9(10)11-2/h3,7-8H,1,4-6H2,2H3/t7-,8-/m1/s1 |
| InChIKey | TYGWXTLTLLABKF-HTQZYQBOSA-N |
| XLogP | 0.87 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|