C14H22F2O4 — CID 71534451
tert-butyl 2-[(4S,6R)-6-ethenyl-5,5-difluoro-2,2-dimethyl-1,3-dioxan-4-yl]acetate (PubChem CID 71534451) has the molecular formula C14H22F2O4 and a molecular weight of 292.32 g/mol. Its IUPAC name is tert-butyl 2-[(4S,6R)-6-ethenyl-5,5-difluoro-2,2-dimethyl-1,3-dioxan-4-yl]acetate.
| Compound Name | tert-butyl 2-[(4S,6R)-6-ethenyl-5,5-difluoro-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
|---|---|
| PubChem CID | 71534451 |
| Molecular Formula | C14H22F2O4 |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | tert-butyl 2-[(4S,6R)-6-ethenyl-5,5-difluoro-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| SMILES | C=C[C@H]1OC(C)(C)O[C@@H](CC(=O)OC(C)(C)C)C1(F)F |
| InChI | InChI=1S/C14H22F2O4/c1-7-9-14(15,16)10(19-13(5,6)18-9)8-11(17)20-12(2,3)4/h7,9-10H,1,8H2,2-6H3/t9-,10+/m1/s1 |
| InChIKey | KRRHTZWRNJPUTH-ZJUUUORDSA-N |
| XLogP | 3.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|