C18H28O5Si2 — CID 134886799
dimethyl 5-oxo-4,6-bis(trimethylsilyl)-1,3-dihydropentalene-2,2-dicarboxylate (PubChem CID 134886799) has the molecular formula C18H28O5Si2 and a molecular weight of 380.59 g/mol. Its IUPAC name is dimethyl 5-oxo-4,6-bis(trimethylsilyl)-1,3-dihydropentalene-2,2-dicarboxylate.
| Compound Name | dimethyl 5-oxo-4,6-bis(trimethylsilyl)-1,3-dihydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 134886799 |
| Molecular Formula | C18H28O5Si2 |
| Molecular Weight | 380.59 g/mol |
| Exact Mass | 380.15 |
| IUPAC Name | dimethyl 5-oxo-4,6-bis(trimethylsilyl)-1,3-dihydropentalene-2,2-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C([Si](C)(C)C)C(=O)C([Si](C)(C)C)=C2C1 |
| InChI | InChI=1S/C18H28O5Si2/c1-22-16(20)18(17(21)23-2)9-11-12(10-18)15(25(6,7)8)13(19)14(11)24(3,4)5/h9-10H2,1-8H3 |
| InChIKey | KSNCKLHUINQUHD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.59 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|