C10H13F6O5P — CID 134887231
methyl (E)-4-[bis(2,2,2-trifluoroethoxy)phosphoryl]pent-2-enoate (PubChem CID 134887231) has the molecular formula C10H13F6O5P and a molecular weight of 358.17 g/mol. Its IUPAC name is methyl (E)-4-[bis(2,2,2-trifluoroethoxy)phosphoryl]pent-2-enoate.
| Compound Name | methyl (E)-4-[bis(2,2,2-trifluoroethoxy)phosphoryl]pent-2-enoate |
|---|---|
| PubChem CID | 134887231 |
| Molecular Formula | C10H13F6O5P |
| Molecular Weight | 358.17 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | methyl (E)-4-[bis(2,2,2-trifluoroethoxy)phosphoryl]pent-2-enoate |
| SMILES | COC(=O)/C=C/C(C)P(=O)(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C10H13F6O5P/c1-7(3-4-8(17)19-2)22(18,20-5-9(11,12)13)21-6-10(14,15)16/h3-4,7H,5-6H2,1-2H3/b4-3+ |
| InChIKey | SDUVNVXDAWBINI-ONEGZZNKSA-N |
| XLogP | 3.45 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.17 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|