C12H18O2 — CID 134887246
(3Z)-4,9-dimethyldeca-3,9-dien-7-yne-1,6-diol (PubChem CID 134887246) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is (3Z)-4,9-dimethyldeca-3,9-dien-7-yne-1,6-diol.
| Compound Name | (3Z)-4,9-dimethyldeca-3,9-dien-7-yne-1,6-diol |
|---|---|
| PubChem CID | 134887246 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | (3Z)-4,9-dimethyldeca-3,9-dien-7-yne-1,6-diol |
| SMILES | C=C(C)C#CC(O)C/C(C)=C\CCO |
| InChI | InChI=1S/C12H18O2/c1-10(2)6-7-12(14)9-11(3)5-4-8-13/h5,12-14H,1,4,8-9H2,2-3H3/b11-5- |
| InChIKey | KEFQLOUYCKBJCU-WZUFQYTHSA-N |
| XLogP | 1.65 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|