C15H32O2Si2 — CID 134887390
tert-butyl-dimethyl-[(3-trimethylsilyloxycyclopenten-1-yl)methoxy]silane (PubChem CID 134887390) has the molecular formula C15H32O2Si2 and a molecular weight of 300.59 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3-trimethylsilyloxycyclopenten-1-yl)methoxy]silane.
| Compound Name | tert-butyl-dimethyl-[(3-trimethylsilyloxycyclopenten-1-yl)methoxy]silane |
|---|---|
| PubChem CID | 134887390 |
| Molecular Formula | C15H32O2Si2 |
| Molecular Weight | 300.59 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | tert-butyl-dimethyl-[(3-trimethylsilyloxycyclopenten-1-yl)methoxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=CC(O[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C15H32O2Si2/c1-15(2,3)19(7,8)16-12-13-9-10-14(11-13)17-18(4,5)6/h11,14H,9-10,12H2,1-8H3 |
| InChIKey | OACIBQFEBQGLHQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.59 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|