C26H24O3S — CID 134887644
15-(benzenesulfonyl)-4,6,8,10-tetramethyl-17-oxatetracyclo[12.2.1.02,13.03,9]heptadeca-2,4,6,8,10,12,15-heptaene (PubChem CID 134887644) has the molecular formula C26H24O3S and a molecular weight of 416.54 g/mol. Its IUPAC name is 15-(benzenesulfonyl)-4,6,8,10-tetramethyl-17-oxatetracyclo[12.2.1.02,13.03,9]heptadeca-2,4,6,8,10,12,15-heptaene.
| Compound Name | 15-(benzenesulfonyl)-4,6,8,10-tetramethyl-17-oxatetracyclo[12.2.1.02,13.03,9]heptadeca-2,4,6,8,10,12,15-heptaene |
|---|---|
| PubChem CID | 134887644 |
| Molecular Formula | C26H24O3S |
| Molecular Weight | 416.54 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | 15-(benzenesulfonyl)-4,6,8,10-tetramethyl-17-oxatetracyclo[12.2.1.02,13.03,9]heptadeca-2,4,6,8,10,12,15-heptaene |
| SMILES | CC1=CC(C)=C2C(C)=CC=C3C(=C2C(C)=C1)C1C=C(S(=O)(=O)c2ccccc2)C3O1 |
| InChI | InChI=1S/C26H24O3S/c1-15-12-17(3)23-16(2)10-11-20-25(24(23)18(4)13-15)21-14-22(26(20)29-21)30(27,28)19-8-6-5-7-9-19/h5-14,21,26H,1-4H3 |
| InChIKey | GJVAXQDPMQAZRR-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |