C32H28O5S2 — CID 134887600
15,16-bis(benzenesulfonyl)-4,6,8,10-tetramethyl-17-oxatetracyclo[12.2.1.02,13.03,9]heptadeca-2,4,6,8,10,12,15-heptaene (PubChem CID 134887600) has the molecular formula C32H28O5S2 and a molecular weight of 556.71 g/mol. Its IUPAC name is 15,16-bis(benzenesulfonyl)-4,6,8,10-tetramethyl-17-oxatetracyclo[12.2.1.02,13.03,9]heptadeca-2,4,6,8,10,12,15-heptaene.
| Compound Name | 15,16-bis(benzenesulfonyl)-4,6,8,10-tetramethyl-17-oxatetracyclo[12.2.1.02,13.03,9]heptadeca-2,4,6,8,10,12,15-heptaene |
|---|---|
| PubChem CID | 134887600 |
| Molecular Formula | C32H28O5S2 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | 15,16-bis(benzenesulfonyl)-4,6,8,10-tetramethyl-17-oxatetracyclo[12.2.1.02,13.03,9]heptadeca-2,4,6,8,10,12,15-heptaene |
| SMILES | CC1=CC(C)=C2C(C)=CC=C3C(=C2C(C)=C1)C1OC3C(S(=O)(=O)c2ccccc2)=C1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H28O5S2/c1-19-17-21(3)26-20(2)15-16-25-28(27(26)22(4)18-19)30-32(39(35,36)24-13-9-6-10-14-24)31(29(25)37-30)38(33,34)23-11-7-5-8-12-23/h5-18,29-30H,1-4H3 |
| InChIKey | QFHVVEDVZSNDJU-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |