C18H16O5S2 — CID 11025212
(1R,4S,5R,6R)-5,6-bis(benzenesulfonyl)-7-oxabicyclo[2.2.1]hept-2-ene (PubChem CID 11025212) has the molecular formula C18H16O5S2 and a molecular weight of 376.46 g/mol. Its IUPAC name is (1R,4S,5R,6R)-5,6-bis(benzenesulfonyl)-7-oxabicyclo[2.2.1]hept-2-ene.
| Compound Name | (1R,4S,5R,6R)-5,6-bis(benzenesulfonyl)-7-oxabicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 11025212 |
| Molecular Formula | C18H16O5S2 |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | (1R,4S,5R,6R)-5,6-bis(benzenesulfonyl)-7-oxabicyclo[2.2.1]hept-2-ene |
| SMILES | O=S(=O)(c1ccccc1)[C@H]1[C@H](S(=O)(=O)c2ccccc2)[C@H]2C=C[C@@H]1O2 |
| InChI | InChI=1S/C18H16O5S2/c19-24(20,13-7-3-1-4-8-13)17-15-11-12-16(23-15)18(17)25(21,22)14-9-5-2-6-10-14/h1-12,15-18H/t15-,16+,17-,18-/m1/s1 |
| InChIKey | XMKRUFVTIUMGBR-XMTFNYHQSA-N |
| XLogP | 2.01 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|