C19H34O5 — CID 134887952
(2R,3S,6S)-3-(1-ethoxyethoxy)-6-[(3S,6R)-6-methoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl]-2-methylheptanal (PubChem CID 134887952) has the molecular formula C19H34O5 and a molecular weight of 342.48 g/mol. Its IUPAC name is (2R,3S,6S)-3-(1-ethoxyethoxy)-6-[(3S,6R)-6-methoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl]-2-methylheptanal.
| Compound Name | (2R,3S,6S)-3-(1-ethoxyethoxy)-6-[(3S,6R)-6-methoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl]-2-methylheptanal |
|---|---|
| PubChem CID | 134887952 |
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | (2R,3S,6S)-3-(1-ethoxyethoxy)-6-[(3S,6R)-6-methoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl]-2-methylheptanal |
| SMILES | CCOC(C)O[C@@H](CC[C@H](C)C1O[C@@H](OC)C=C[C@@H]1C)C(C)C=O |
| InChI | InChI=1S/C19H34O5/c1-7-22-16(5)23-17(15(4)12-20)10-8-13(2)19-14(3)9-11-18(21-6)24-19/h9,11-19H,7-8,10H2,1-6H3/t13-,14-,15?,16?,17-,18+,19?/m0/s1 |
| InChIKey | JOAJQWBTCKRPFM-XBDBWBMKSA-N |
| XLogP | 3.57 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|