C19H34O5 — CID 134939966
(2R,3S,6S)-3-(2-ethoxyethoxy)-6-[(2S,3S,6R)-6-methoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl]-2-methylheptanal (PubChem CID 134939966) has the molecular formula C19H34O5 and a molecular weight of 342.48 g/mol. Its IUPAC name is (2R,3S,6S)-3-(2-ethoxyethoxy)-6-[(2S,3S,6R)-6-methoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl]-2-methylheptanal.
| Compound Name | (2R,3S,6S)-3-(2-ethoxyethoxy)-6-[(2S,3S,6R)-6-methoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl]-2-methylheptanal |
|---|---|
| PubChem CID | 134939966 |
| Molecular Formula | C19H34O5 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.24 |
| IUPAC Name | (2R,3S,6S)-3-(2-ethoxyethoxy)-6-[(2S,3S,6R)-6-methoxy-3-methyl-3,6-dihydro-2H-pyran-2-yl]-2-methylheptanal |
| SMILES | CCOCCO[C@@H](CC[C@H](C)[C@@H]1O[C@@H](OC)C=C[C@@H]1C)[C@@H](C)C=O |
| InChI | InChI=1S/C19H34O5/c1-6-22-11-12-23-17(16(4)13-20)9-7-14(2)19-15(3)8-10-18(21-5)24-19/h8,10,13-19H,6-7,9,11-12H2,1-5H3/t14-,15-,16-,17-,18+,19-/m0/s1 |
| InChIKey | FFZOBYKFNJWCEZ-VIUKOLAESA-N |
| XLogP | 3.22 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|