C21H34O7 — CID 59566113
[(2S,3S,4E,6R)-2-methoxy-4-(2-methoxy-2-oxoethylidene)-6-(2-methylbutyl)-2-(2-methyl-1-oxopropan-2-yl)oxan-3-yl] propanoate (PubChem CID 59566113) has the molecular formula C21H34O7 and a molecular weight of 398.50 g/mol. Its IUPAC name is [(2S,3S,4E,6R)-2-methoxy-4-(2-methoxy-2-oxoethylidene)-6-(2-methylbutyl)-2-(2-methyl-1-oxopropan-2-yl)oxan-3-yl] propanoate.
| Compound Name | [(2S,3S,4E,6R)-2-methoxy-4-(2-methoxy-2-oxoethylidene)-6-(2-methylbutyl)-2-(2-methyl-1-oxopropan-2-yl)oxan-3-yl] propanoate |
|---|---|
| PubChem CID | 59566113 |
| Molecular Formula | C21H34O7 |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.23 |
| IUPAC Name | [(2S,3S,4E,6R)-2-methoxy-4-(2-methoxy-2-oxoethylidene)-6-(2-methylbutyl)-2-(2-methyl-1-oxopropan-2-yl)oxan-3-yl] propanoate |
| SMILES | CCC(=O)O[C@H]1/C(=C/C(=O)OC)C[C@@H](CC(C)CC)O[C@@]1(OC)C(C)(C)C=O |
| InChI | InChI=1S/C21H34O7/c1-8-14(3)10-16-11-15(12-18(24)25-6)19(27-17(23)9-2)21(26-7,28-16)20(4,5)13-22/h12-14,16,19H,8-11H2,1-7H3/b15-12+/t14?,16-,19+,21-/m1/s1 |
| InChIKey | GLTZIQGJERADGJ-IHGWCYSGSA-N |
| XLogP | 3.20 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|