C15H18 — CID 134888030
1-[(Z)-but-1-en-3-ynyl]-2-hex-1-ynylcyclopentene (PubChem CID 134888030) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-[(Z)-but-1-en-3-ynyl]-2-hex-1-ynylcyclopentene.
| Compound Name | 1-[(Z)-but-1-en-3-ynyl]-2-hex-1-ynylcyclopentene |
|---|---|
| PubChem CID | 134888030 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 1-[(Z)-but-1-en-3-ynyl]-2-hex-1-ynylcyclopentene |
| SMILES | C#C/C=C\C1=C(C#CCCCC)CCC1 |
| InChI | InChI=1S/C15H18/c1-3-5-7-8-11-15-13-9-12-14(15)10-6-4-2/h2,6,10H,3,5,7,9,12-13H2,1H3/b10-6- |
| InChIKey | BPOZRWCAOOIEPF-POHAHGRESA-N |
| XLogP | 3.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|