C17H22 — CID 10998721
1-hex-1-ynyl-2-(4-methylpenta-1,2,3-trienyl)cyclopentene (PubChem CID 10998721) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-hex-1-ynyl-2-(4-methylpenta-1,2,3-trienyl)cyclopentene.
| Compound Name | 1-hex-1-ynyl-2-(4-methylpenta-1,2,3-trienyl)cyclopentene |
|---|---|
| PubChem CID | 10998721 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-hex-1-ynyl-2-(4-methylpenta-1,2,3-trienyl)cyclopentene |
| SMILES | CCCCC#CC1=C(C=C=C=C(C)C)CCC1 |
| InChI | InChI=1S/C17H22/c1-4-5-6-7-11-16-13-9-14-17(16)12-8-10-15(2)3/h12H,4-6,9,13-14H2,1-3H3 |
| InChIKey | OJTVHVBCOVSFAH-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|