C17H26 — CID 15721130
(4Z)-8-butyl-4-methyldodeca-4,6,7-trien-2-yne (PubChem CID 15721130) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is (4Z)-8-butyl-4-methyldodeca-4,6,7-trien-2-yne.
| Compound Name | (4Z)-8-butyl-4-methyldodeca-4,6,7-trien-2-yne |
|---|---|
| PubChem CID | 15721130 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | (4Z)-8-butyl-4-methyldodeca-4,6,7-trien-2-yne |
| SMILES | CC#C/C(C)=C\C=C=C(CCCC)CCCC |
| InChI | InChI=1S/C17H26/c1-5-8-13-17(14-9-6-2)15-10-12-16(4)11-7-3/h10,12H,5-6,8-9,13-14H2,1-4H3/b16-12- |
| InChIKey | BJXDISSJROEYLH-VBKFSLOCSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|