C17H26 — CID 14979783
(5Z)-6-butyl-2-methyldodeca-2,3,5-trien-7-yne (PubChem CID 14979783) has the molecular formula C17H26 and a molecular weight of 230.39 g/mol. Its IUPAC name is (5Z)-6-butyl-2-methyldodeca-2,3,5-trien-7-yne.
| Compound Name | (5Z)-6-butyl-2-methyldodeca-2,3,5-trien-7-yne |
|---|---|
| PubChem CID | 14979783 |
| Molecular Formula | C17H26 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | (5Z)-6-butyl-2-methyldodeca-2,3,5-trien-7-yne |
| SMILES | CCCCC#C/C(=C\C=C=C(C)C)CCCC |
| InChI | InChI=1S/C17H26/c1-5-7-9-10-14-17(13-8-6-2)15-11-12-16(3)4/h11,15H,5-9,13H2,1-4H3/b17-15- |
| InChIKey | XYMFEAWYCHAZFD-ICFOKQHNSA-N |
| XLogP | 5.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|