C18H30 — CID 10900945
(3E,5Z)-4,5,6-triethyldodeca-3,5-dien-7-yne (PubChem CID 10900945) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is (3E,5Z)-4,5,6-triethyldodeca-3,5-dien-7-yne.
| Compound Name | (3E,5Z)-4,5,6-triethyldodeca-3,5-dien-7-yne |
|---|---|
| PubChem CID | 10900945 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | (3E,5Z)-4,5,6-triethyldodeca-3,5-dien-7-yne |
| SMILES | CC/C=C(CC)/C(CC)=C(\C#CCCCC)CC |
| InChI | InChI=1S/C18H30/c1-6-11-12-13-15-17(9-4)18(10-5)16(8-3)14-7-2/h14H,6-12H2,1-5H3/b16-14+,18-17- |
| InChIKey | NMQVSKMYNAWOET-YDNIAVERSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|