C34H72O2Sn2 — CID 134889001
tributyl-[(1S,2R,3S)-1-butyl-2-(methoxymethoxymethyl)-3-tributylstannylcyclopropyl]stannane (PubChem CID 134889001) has the molecular formula C34H72O2Sn2 and a molecular weight of 750.37 g/mol. Its IUPAC name is tributyl-[(1S,2R,3S)-1-butyl-2-(methoxymethoxymethyl)-3-tributylstannylcyclopropyl]stannane.
| Compound Name | tributyl-[(1S,2R,3S)-1-butyl-2-(methoxymethoxymethyl)-3-tributylstannylcyclopropyl]stannane |
|---|---|
| PubChem CID | 134889001 |
| Molecular Formula | C34H72O2Sn2 |
| Molecular Weight | 750.37 g/mol |
| Exact Mass | 752.36 |
| IUPAC Name | tributyl-[(1S,2R,3S)-1-butyl-2-(methoxymethoxymethyl)-3-tributylstannylcyclopropyl]stannane |
| SMILES | CCCC[C@]1([Sn](CCCC)(CCCC)CCCC)[C@H](COCOC)[C@@H]1[Sn](CCCC)(CCCC)CCCC |
| InChI | InChI=1S/C10H18O2.6C4H9.2Sn/c1-3-4-5-9-6-10(9)7-12-8-11-2;6*1-3-4-2;;/h6,10H,3-5,7-8H2,1-2H3;6*1,3-4H2,2H3;;/t10-;;;;;;;;/m0......../s1 |
| InChIKey | FDAWRYIYDVKSIH-IJYJYDAPSA-N |
| XLogP | 12.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 750.37 |
| LogP ≤ 5 | 12.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|