C22H46O2Sn — CID 23660647
tributyl-[(1R,2S)-1-butyl-2-(methoxymethoxymethyl)cyclopropyl]stannane (PubChem CID 23660647) has the molecular formula C22H46O2Sn and a molecular weight of 461.32 g/mol. Its IUPAC name is tributyl-[(1R,2S)-1-butyl-2-(methoxymethoxymethyl)cyclopropyl]stannane.
| Compound Name | tributyl-[(1R,2S)-1-butyl-2-(methoxymethoxymethyl)cyclopropyl]stannane |
|---|---|
| PubChem CID | 23660647 |
| Molecular Formula | C22H46O2Sn |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | tributyl-[(1R,2S)-1-butyl-2-(methoxymethoxymethyl)cyclopropyl]stannane |
| SMILES | CCCC[C@@]1([Sn](CCCC)(CCCC)CCCC)C[C@H]1COCOC |
| InChI | InChI=1S/C10H19O2.3C4H9.Sn/c1-3-4-5-9-6-10(9)7-12-8-11-2;3*1-3-4-2;/h10H,3-8H2,1-2H3;3*1,3-4H2,2H3;/t10-;;;;/m0..../s1 |
| InChIKey | UZUQFNFMMXSJSX-CZEDPBFNSA-N |
| XLogP | 7.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|