C13H26O2 — CID 101213914
cis-(1R,2R)-1-hexyl-2-(methoxymethoxymethyl)-1-methylcyclopropane (PubChem CID 101213914) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is cis-(1R,2R)-1-hexyl-2-(methoxymethoxymethyl)-1-methylcyclopropane.
| Compound Name | cis-(1R,2R)-1-hexyl-2-(methoxymethoxymethyl)-1-methylcyclopropane |
|---|---|
| PubChem CID | 101213914 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | cis-(1R,2R)-1-hexyl-2-(methoxymethoxymethyl)-1-methylcyclopropane |
| SMILES | CCCCCC[C@]1(C)C[C@H]1COCOC |
| InChI | InChI=1S/C13H26O2/c1-4-5-6-7-8-13(2)9-12(13)10-15-11-14-3/h12H,4-11H2,1-3H3/t12-,13+/m0/s1 |
| InChIKey | ODCUDLGNVSKEFN-QWHCGFSZSA-N |
| XLogP | 3.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|