C14H28O2 — CID 101213922
trans-(1R,2R)-1-ethyl-1-hexyl-2-(methoxymethoxymethyl)cyclopropane (PubChem CID 101213922) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is trans-(1R,2R)-1-ethyl-1-hexyl-2-(methoxymethoxymethyl)cyclopropane.
| Compound Name | trans-(1R,2R)-1-ethyl-1-hexyl-2-(methoxymethoxymethyl)cyclopropane |
|---|---|
| PubChem CID | 101213922 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | trans-(1R,2R)-1-ethyl-1-hexyl-2-(methoxymethoxymethyl)cyclopropane |
| SMILES | CCCCCC[C@]1(CC)C[C@H]1COCOC |
| InChI | InChI=1S/C14H28O2/c1-4-6-7-8-9-14(5-2)10-13(14)11-16-12-15-3/h13H,4-12H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | YDNGCOUJXXSNAR-UONOGXRCSA-N |
| XLogP | 3.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|