C17H33B — CID 134890558
1,2-bis(2,3-dimethylbutyl)-4-methyl-2,5-dihydroborole (PubChem CID 134890558) has the molecular formula C17H33B and a molecular weight of 248.26 g/mol. Its IUPAC name is 1,2-bis(2,3-dimethylbutyl)-4-methyl-2,5-dihydroborole.
| Compound Name | 1,2-bis(2,3-dimethylbutyl)-4-methyl-2,5-dihydroborole |
|---|---|
| PubChem CID | 134890558 |
| Molecular Formula | C17H33B |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 248.27 |
| IUPAC Name | 1,2-bis(2,3-dimethylbutyl)-4-methyl-2,5-dihydroborole |
| SMILES | CC1=CC(CC(C)C(C)C)B(CC(C)C(C)C)C1 |
| InChI | InChI=1S/C17H33B/c1-12(2)15(6)9-17-8-14(5)10-18(17)11-16(7)13(3)4/h8,12-13,15-17H,9-11H2,1-7H3 |
| InChIKey | KVFBDNVVQFPWEU-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|