C12H19BO4 — CID 134890675
1-[(4R,5R)-5-acetyl-2-[(E)-hex-1-enyl]-1,3,2-dioxaborolan-4-yl]ethanone (PubChem CID 134890675) has the molecular formula C12H19BO4 and a molecular weight of 238.09 g/mol. Its IUPAC name is 1-[(4R,5R)-5-acetyl-2-[(E)-hex-1-enyl]-1,3,2-dioxaborolan-4-yl]ethanone.
| Compound Name | 1-[(4R,5R)-5-acetyl-2-[(E)-hex-1-enyl]-1,3,2-dioxaborolan-4-yl]ethanone |
|---|---|
| PubChem CID | 134890675 |
| Molecular Formula | C12H19BO4 |
| Molecular Weight | 238.09 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1-[(4R,5R)-5-acetyl-2-[(E)-hex-1-enyl]-1,3,2-dioxaborolan-4-yl]ethanone |
| SMILES | CCCC/C=C/B1O[C@@H](C(C)=O)[C@H](C(C)=O)O1 |
| InChI | InChI=1S/C12H19BO4/c1-4-5-6-7-8-13-16-11(9(2)14)12(17-13)10(3)15/h7-8,11-12H,4-6H2,1-3H3/b8-7+/t11-,12-/m0/s1 |
| InChIKey | YQJVAASJQZLHDQ-BRQSLIGTSA-N |
| XLogP | 1.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.09 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|