C7H10O — CID 134893405
5-methylhexa-1,5-dien-1-one (PubChem CID 134893405) has the molecular formula C7H10O and a molecular weight of 110.16 g/mol. Its IUPAC name is 5-methylhexa-1,5-dien-1-one.
| Compound Name | 5-methylhexa-1,5-dien-1-one |
|---|---|
| PubChem CID | 134893405 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | 5-methylhexa-1,5-dien-1-one |
| SMILES | C=C(C)CCC=C=O |
| InChI | InChI=1S/C7H10O/c1-7(2)5-3-4-6-8/h4H,1,3,5H2,2H3 |
| InChIKey | ORXGUIMYEIDYEY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|