About 5-methylhexa-1,5-dien-1-one
5-methylhexa-1,5-dien-1-one (PubChem CID 134893405) has the molecular formula C7H10O
and a molecular weight of 110.16 g/mol. Its IUPAC name is 5-methylhexa-1,5-dien-1-one.
Molecular Properties
| Compound Name | 5-methylhexa-1,5-dien-1-one |
| PubChem CID | 134893405 |
| Molecular Formula | C7H10O |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.07 |
| IUPAC Name | 5-methylhexa-1,5-dien-1-one |
| SMILES | C=C(C)CCC=C=O |
| InChI | InChI=1S/C7H10O/c1-7(2)5-3-4-6-8/h4H,1,3,5H2,2H3 |
| InChIKey | ORXGUIMYEIDYEY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze 5-methylhexa-1,5-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylhexa-1,5-dien-1-one?
The IUPAC name of 5-methylhexa-1,5-dien-1-one (CID 134893405) is 5-methylhexa-1,5-dien-1-one.
What is the SMILES notation for 5-methylhexa-1,5-dien-1-one?
The canonical SMILES for 5-methylhexa-1,5-dien-1-one is C=C(C)CCC=C=O.
What is the InChIKey of 5-methylhexa-1,5-dien-1-one?
The InChIKey is ORXGUIMYEIDYEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O/c1-7(2)5-3-4-6-8/h4H,1,3,5H2,2H3.
What are the key properties of 5-methylhexa-1,5-dien-1-one?
5-methylhexa-1,5-dien-1-one has a molecular weight of 110.16 g/mol, XLogP of 1.73, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylhexa-1,5-dien-1-one is sourced from PubChem (CID 134893405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).