potassium 1-methyl-2-(pyridin-4-ylmethyl)indole

C15H13KN2 — CID 134893532

IUPACpotassium 1-methyl-2-(pyridin-4-ylmethyl)indole
SMILESCn1c([CH-]c2ccncc2)cc2ccccc21.[K+]
InChIInChI=1S/C15H13N2.K/c1-17-14(10-12-6-8-16-9-7-12)11-13-4-2-3-5-15(13)17;/h2-11H,1H3;/q-1;+1
InChIKeyLRYPMSVSBBXHEX-UHFFFAOYSA-N
MW260.38 g/mol
LogP0.18
Rot. Bonds2

About potassium 1-methyl-2-(pyridin-4-ylmethyl)indole

potassium 1-methyl-2-(pyridin-4-ylmethyl)indole (PubChem CID 134893532) has the molecular formula C15H13KN2 and a molecular weight of 260.38 g/mol. Its IUPAC name is potassium 1-methyl-2-(pyridin-4-ylmethyl)indole.

Molecular Properties

Compound Namepotassium 1-methyl-2-(pyridin-4-ylmethyl)indole
PubChem CID134893532
Molecular FormulaC15H13KN2
Molecular Weight260.38 g/mol
Exact Mass260.07
IUPAC Namepotassium 1-methyl-2-(pyridin-4-ylmethyl)indole
SMILESCn1c([CH-]c2ccncc2)cc2ccccc21.[K+]
InChIInChI=1S/C15H13N2.K/c1-17-14(10-12-6-8-16-9-7-12)11-13-4-2-3-5-15(13)17;/h2-11H,1H3;/q-1;+1
InChIKeyLRYPMSVSBBXHEX-UHFFFAOYSA-N
XLogP0.18
TPSA17.82 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.38
LogP ≤ 50.18
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}

Analyze potassium 1-methyl-2-(pyridin-4-ylmethyl)indole with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium 1-methyl-2-(pyridin-4-ylmethyl)indole?
The IUPAC name of potassium 1-methyl-2-(pyridin-4-ylmethyl)indole (CID 134893532) is potassium 1-methyl-2-(pyridin-4-ylmethyl)indole.
What is the SMILES notation for potassium 1-methyl-2-(pyridin-4-ylmethyl)indole?
The canonical SMILES for potassium 1-methyl-2-(pyridin-4-ylmethyl)indole is Cn1c([CH-]c2ccncc2)cc2ccccc21.[K+].
What is the InChIKey of potassium 1-methyl-2-(pyridin-4-ylmethyl)indole?
The InChIKey is LRYPMSVSBBXHEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N2.K/c1-17-14(10-12-6-8-16-9-7-12)11-13-4-2-3-5-15(13)17;/h2-11H,1H3;/q-1;+1.
What are the key properties of potassium 1-methyl-2-(pyridin-4-ylmethyl)indole?
potassium 1-methyl-2-(pyridin-4-ylmethyl)indole has a molecular weight of 260.38 g/mol, XLogP of 0.18, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 1-methyl-2-(pyridin-4-ylmethyl)indole is sourced from PubChem (CID 134893532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).