About 2-decan-2-yl-3-methyl-4,5-dihydro-1H-imidazol-3-ium
2-decan-2-yl-3-methyl-4,5-dihydro-1H-imidazol-3-ium (PubChem CID 134893765) has the molecular formula C14H29N2+
and a molecular weight of 225.40 g/mol. Its IUPAC name is 2-decan-2-yl-3-methyl-4,5-dihydro-1H-imidazol-3-ium.
Molecular Properties
| Compound Name | 2-decan-2-yl-3-methyl-4,5-dihydro-1H-imidazol-3-ium |
| PubChem CID | 134893765 |
| Molecular Formula | C14H29N2+ |
| Molecular Weight | 225.40 g/mol |
| Exact Mass | 225.23 |
| IUPAC Name | 2-decan-2-yl-3-methyl-4,5-dihydro-1H-imidazol-3-ium |
| SMILES | CCCCCCCCC(C)C1=[N+](C)CCN1 |
| InChI | InChI=1S/C14H28N2/c1-4-5-6-7-8-9-10-13(2)14-15-11-12-16(14)3/h13H,4-12H2,1-3H3/p+1 |
| InChIKey | QBQGOIFSLVVQIB-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 15.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-decan-2-yl-3-methyl-4,5-dihydro-1H-imidazol-3-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-decan-2-yl-3-methyl-4,5-dihydro-1H-imidazol-3-ium?
The IUPAC name of 2-decan-2-yl-3-methyl-4,5-dihydro-1H-imidazol-3-ium (CID 134893765) is 2-decan-2-yl-3-methyl-4,5-dihydro-1H-imidazol-3-ium.
What is the SMILES notation for 2-decan-2-yl-3-methyl-4,5-dihydro-1H-imidazol-3-ium?
The canonical SMILES for 2-decan-2-yl-3-methyl-4,5-dihydro-1H-imidazol-3-ium is CCCCCCCCC(C)C1=[N+](C)CCN1.
What is the InChIKey of 2-decan-2-yl-3-methyl-4,5-dihydro-1H-imidazol-3-ium?
The InChIKey is QBQGOIFSLVVQIB-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H28N2/c1-4-5-6-7-8-9-10-13(2)14-15-11-12-16(14)3/h13H,4-12H2,1-3H3/p+1.
What are the key properties of 2-decan-2-yl-3-methyl-4,5-dihydro-1H-imidazol-3-ium?
2-decan-2-yl-3-methyl-4,5-dihydro-1H-imidazol-3-ium has a molecular weight of 225.40 g/mol, XLogP of 3.02, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-decan-2-yl-3-methyl-4,5-dihydro-1H-imidazol-3-ium is sourced from PubChem (CID 134893765), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).