C15H13NaTe — CID 134895508
1,1-diphenylprop-1-en-2-yltellanylsodium (PubChem CID 134895508) has the molecular formula C15H13NaTe and a molecular weight of 343.86 g/mol. Its IUPAC name is 1,1-diphenylprop-1-en-2-yltellanylsodium.
| Compound Name | 1,1-diphenylprop-1-en-2-yltellanylsodium |
|---|---|
| PubChem CID | 134895508 |
| Molecular Formula | C15H13NaTe |
| Molecular Weight | 343.86 g/mol |
| Exact Mass | 346.00 |
| IUPAC Name | 1,1-diphenylprop-1-en-2-yltellanylsodium |
| SMILES | CC([Te][Na])=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H14Te.Na/c1-12(16)15(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-11,16H,1H3;/q;+1/p-1 |
| InChIKey | WOLKGMXKUZTYCD-UHFFFAOYSA-M |
| XLogP | 3.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.86 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|