C13H24O3 — CID 134895945
[(E,2S,3S)-3-hydroxy-2-methylhept-4-enyl] 2,2-dimethylpropanoate (PubChem CID 134895945) has the molecular formula C13H24O3 and a molecular weight of 228.33 g/mol. Its IUPAC name is [(E,2S,3S)-3-hydroxy-2-methylhept-4-enyl] 2,2-dimethylpropanoate.
| Compound Name | [(E,2S,3S)-3-hydroxy-2-methylhept-4-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 134895945 |
| Molecular Formula | C13H24O3 |
| Molecular Weight | 228.33 g/mol |
| Exact Mass | 228.17 |
| IUPAC Name | [(E,2S,3S)-3-hydroxy-2-methylhept-4-enyl] 2,2-dimethylpropanoate |
| SMILES | CC/C=C/[C@H](O)[C@@H](C)COC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H24O3/c1-6-7-8-11(14)10(2)9-16-12(15)13(3,4)5/h7-8,10-11,14H,6,9H2,1-5H3/b8-7+/t10-,11-/m0/s1 |
| InChIKey | QQVXMHFLFPPAOG-IJUHFESZSA-N |
| XLogP | 2.54 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|