C15H29NOSi — CID 134896031
(2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-3-propan-2-ylpent-4-enenitrile (PubChem CID 134896031) has the molecular formula C15H29NOSi and a molecular weight of 267.49 g/mol. Its IUPAC name is (2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-3-propan-2-ylpent-4-enenitrile.
| Compound Name | (2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-3-propan-2-ylpent-4-enenitrile |
|---|---|
| PubChem CID | 134896031 |
| Molecular Formula | C15H29NOSi |
| Molecular Weight | 267.49 g/mol |
| Exact Mass | 267.20 |
| IUPAC Name | (2R,3S)-2-[tert-butyl(dimethyl)silyl]oxy-3-methyl-3-propan-2-ylpent-4-enenitrile |
| SMILES | C=C[C@](C)(C(C)C)[C@H](C#N)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29NOSi/c1-10-15(7,12(2)3)13(11-16)17-18(8,9)14(4,5)6/h10,12-13H,1H2,2-9H3/t13-,15+/m0/s1 |
| InChIKey | PHKZMYGPXZRDEG-DZGCQCFKSA-N |
| XLogP | 4.75 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|