C16H33NO2Si2 — CID 101444805
(E,2S)-4-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxybut-3-enenitrile (PubChem CID 101444805) has the molecular formula C16H33NO2Si2 and a molecular weight of 327.62 g/mol. Its IUPAC name is (E,2S)-4-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxybut-3-enenitrile.
| Compound Name | (E,2S)-4-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxybut-3-enenitrile |
|---|---|
| PubChem CID | 101444805 |
| Molecular Formula | C16H33NO2Si2 |
| Molecular Weight | 327.62 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | (E,2S)-4-[tert-butyl(dimethyl)silyl]-2-[tert-butyl(dimethyl)silyl]oxy-4-hydroxybut-3-enenitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](C#N)/C=C(\O)[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H33NO2Si2/c1-15(2,3)20(7,8)14(18)11-13(12-17)19-21(9,10)16(4,5)6/h11,13,18H,1-10H3/b14-11+/t13-/m0/s1 |
| InChIKey | QGMSFSJPVVXVMB-UQRISPGASA-N |
| XLogP | 5.39 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|