C19H23NO2Si — CID 134899912
3-[3-(hydroxymethyl)-2-trimethylsilylcyclobuta-1,3-dien-1-yl]-1-indol-1-ylpropan-1-one (PubChem CID 134899912) has the molecular formula C19H23NO2Si and a molecular weight of 325.48 g/mol. Its IUPAC name is 3-[3-(hydroxymethyl)-2-trimethylsilylcyclobuta-1,3-dien-1-yl]-1-indol-1-ylpropan-1-one.
| Compound Name | 3-[3-(hydroxymethyl)-2-trimethylsilylcyclobuta-1,3-dien-1-yl]-1-indol-1-ylpropan-1-one |
|---|---|
| PubChem CID | 134899912 |
| Molecular Formula | C19H23NO2Si |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 3-[3-(hydroxymethyl)-2-trimethylsilylcyclobuta-1,3-dien-1-yl]-1-indol-1-ylpropan-1-one |
| SMILES | C[Si](C)(C)C1=C(CCC(=O)n2ccc3ccccc32)C=C1CO |
| InChI | InChI=1S/C19H23NO2Si/c1-23(2,3)19-15(12-16(19)13-21)8-9-18(22)20-11-10-14-6-4-5-7-17(14)20/h4-7,10-12,21H,8-9,13H2,1-3H3 |
| InChIKey | XXWCGZLGFKAJMD-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|