C17H38O4Si2 — CID 134901054
(3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-3-trimethylsilylhex-1-en-3-ol (PubChem CID 134901054) has the molecular formula C17H38O4Si2 and a molecular weight of 362.66 g/mol. Its IUPAC name is (3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-3-trimethylsilylhex-1-en-3-ol.
| Compound Name | (3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-3-trimethylsilylhex-1-en-3-ol |
|---|---|
| PubChem CID | 134901054 |
| Molecular Formula | C17H38O4Si2 |
| Molecular Weight | 362.66 g/mol |
| Exact Mass | 362.23 |
| IUPAC Name | (3R,4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(methoxymethoxy)-3-trimethylsilylhex-1-en-3-ol |
| SMILES | C=C[C@](O)([C@@H](OCOC)[C@@H](C)O[Si](C)(C)C(C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C17H38O4Si2/c1-12-17(18,22(7,8)9)15(20-13-19-6)14(2)21-23(10,11)16(3,4)5/h12,14-15,18H,1,13H2,2-11H3/t14-,15+,17-/m1/s1 |
| InChIKey | CGKCMJBNEYDCRF-HLLBOEOZSA-N |
| XLogP | 4.18 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.66 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|