C18H36O6Si — CID 11111598
(1R)-1-[(2R,3S,5R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]prop-2-en-1-ol (PubChem CID 11111598) has the molecular formula C18H36O6Si and a molecular weight of 376.57 g/mol. Its IUPAC name is (1R)-1-[(2R,3S,5R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]prop-2-en-1-ol.
| Compound Name | (1R)-1-[(2R,3S,5R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]prop-2-en-1-ol |
|---|---|
| PubChem CID | 11111598 |
| Molecular Formula | C18H36O6Si |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | (1R)-1-[(2R,3S,5R,6R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]-5,6-dimethoxy-5,6-dimethyl-1,4-dioxan-2-yl]prop-2-en-1-ol |
| SMILES | C=C[C@@H](O)[C@H]1O[C@@](C)(OC)[C@](C)(OC)O[C@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H36O6Si/c1-11-13(19)15-14(12-22-25(9,10)16(2,3)4)23-17(5,20-7)18(6,21-8)24-15/h11,13-15,19H,1,12H2,2-10H3/t13-,14+,15-,17-,18-/m1/s1 |
| InChIKey | TYUBWFQBGFGYNS-JAPOXJDPSA-N |
| XLogP | 3.06 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|