C23H48O5Si2 — CID 10575966
(2E,4S,5R,7E)-1,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(methoxymethoxy)nona-2,7-dien-4-ol (PubChem CID 10575966) has the molecular formula C23H48O5Si2 and a molecular weight of 460.80 g/mol. Its IUPAC name is (2E,4S,5R,7E)-1,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(methoxymethoxy)nona-2,7-dien-4-ol.
| Compound Name | (2E,4S,5R,7E)-1,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(methoxymethoxy)nona-2,7-dien-4-ol |
|---|---|
| PubChem CID | 10575966 |
| Molecular Formula | C23H48O5Si2 |
| Molecular Weight | 460.80 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | (2E,4S,5R,7E)-1,9-bis[[tert-butyl(dimethyl)silyl]oxy]-5-(methoxymethoxy)nona-2,7-dien-4-ol |
| SMILES | COCO[C@H](C/C=C/CO[Si](C)(C)C(C)(C)C)[C@@H](O)/C=C/CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H48O5Si2/c1-22(2,3)29(8,9)27-17-13-12-16-21(26-19-25-7)20(24)15-14-18-28-30(10,11)23(4,5)6/h12-15,20-21,24H,16-19H2,1-11H3/b13-12+,15-14+/t20-,21+/m0/s1 |
| InChIKey | WXZOYUHPXKQURG-SFTUGDBKSA-N |
| XLogP | 5.88 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.80 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|