C15H32O5Si — CID 101010604
5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)pent-1-en-3-ol (PubChem CID 101010604) has the molecular formula C15H32O5Si and a molecular weight of 320.50 g/mol. Its IUPAC name is 5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)pent-1-en-3-ol.
| Compound Name | 5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)pent-1-en-3-ol |
|---|---|
| PubChem CID | 101010604 |
| Molecular Formula | C15H32O5Si |
| Molecular Weight | 320.50 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 5-[tert-butyl(dimethyl)silyl]oxy-4-(2-methoxyethoxymethoxy)pent-1-en-3-ol |
| SMILES | C=CC(O)C(CO[Si](C)(C)C(C)(C)C)OCOCCOC |
| InChI | InChI=1S/C15H32O5Si/c1-8-13(16)14(19-12-18-10-9-17-5)11-20-21(6,7)15(2,3)4/h8,13-14,16H,1,9-12H2,2-7H3 |
| InChIKey | ZLMWPHCDKCKLFE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.50 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|