C12H25BO — CID 134903557
2,2,3,4-tetraethyl-1-methyl-1-oxonia-2-boranuidacyclopent-3-ene (PubChem CID 134903557) has the molecular formula C12H25BO and a molecular weight of 196.14 g/mol. Its IUPAC name is 2,2,3,4-tetraethyl-1-methyl-1-oxonia-2-boranuidacyclopent-3-ene.
| Compound Name | 2,2,3,4-tetraethyl-1-methyl-1-oxonia-2-boranuidacyclopent-3-ene |
|---|---|
| PubChem CID | 134903557 |
| Molecular Formula | C12H25BO |
| Molecular Weight | 196.14 g/mol |
| Exact Mass | 196.20 |
| IUPAC Name | 2,2,3,4-tetraethyl-1-methyl-1-oxonia-2-boranuidacyclopent-3-ene |
| SMILES | CCC1=C(CC)[B-](CC)(CC)[O+](C)C1 |
| InChI | InChI=1S/C12H25BO/c1-6-11-10-14(5)13(8-3,9-4)12(11)7-2/h6-10H2,1-5H3 |
| InChIKey | JFTWCXWJMOMNLC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 2.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.14 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|