C11H23BO — CID 134978630
2,2,3-triethyl-1,4-dimethyl-1-oxonia-2-boranuidacyclopent-3-ene (PubChem CID 134978630) has the molecular formula C11H23BO and a molecular weight of 182.12 g/mol. Its IUPAC name is 2,2,3-triethyl-1,4-dimethyl-1-oxonia-2-boranuidacyclopent-3-ene.
| Compound Name | 2,2,3-triethyl-1,4-dimethyl-1-oxonia-2-boranuidacyclopent-3-ene |
|---|---|
| PubChem CID | 134978630 |
| Molecular Formula | C11H23BO |
| Molecular Weight | 182.12 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 2,2,3-triethyl-1,4-dimethyl-1-oxonia-2-boranuidacyclopent-3-ene |
| SMILES | CCC1=C(C)C[O+](C)[B-]1(CC)CC |
| InChI | InChI=1S/C11H23BO/c1-6-11-10(4)9-13(5)12(11,7-2)8-3/h6-9H2,1-5H3 |
| InChIKey | RWMLKJOIEXXALY-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 2.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.12 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|