C9H18O — CID 172593077
ethane;3-ethyl-4-methyl-2,5-dihydrofuran (PubChem CID 172593077) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is ethane;3-ethyl-4-methyl-2,5-dihydrofuran.
| Compound Name | ethane;3-ethyl-4-methyl-2,5-dihydrofuran |
|---|---|
| PubChem CID | 172593077 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | ethane;3-ethyl-4-methyl-2,5-dihydrofuran |
| SMILES | CC.CCC1=C(C)COC1 |
| InChI | InChI=1S/C7H12O.C2H6/c1-3-7-5-8-4-6(7)2;1-2/h3-5H2,1-2H3;1-2H3 |
| InChIKey | DOFYZLRTDASADU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|