About CID 134904157
CID 134904157 (PubChem CID 134904157) has the molecular formula C22H23BO2P
and a molecular weight of 361.21 g/mol.
Molecular Properties
| Compound Name | CID 134904157 |
| PubChem CID | 134904157 |
| Molecular Formula | C22H23BO2P |
| Molecular Weight | 361.21 g/mol |
| Exact Mass | 361.15 |
| IUPAC Name | — |
| SMILES | [B-][P+](C)(CC(O)(c1ccccc1)c1ccccc1)c1ccccc1OC |
| InChI | InChI=1S/C22H23BO2P/c1-25-20-15-9-10-16-21(20)26(2,23)17-22(24,18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-16,24H,17H2,1-2H3 |
| InChIKey | WYIOXNXMMRBXAL-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.21 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 134904157 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 134904157?
The IUPAC name of CID 134904157 (CID 134904157) is not available.
What is the SMILES notation for CID 134904157?
The canonical SMILES for CID 134904157 is [B-][P+](C)(CC(O)(c1ccccc1)c1ccccc1)c1ccccc1OC.
What is the InChIKey of CID 134904157?
The InChIKey is WYIOXNXMMRBXAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23BO2P/c1-25-20-15-9-10-16-21(20)26(2,23)17-22(24,18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-16,24H,17H2,1-2H3.
What are the key properties of CID 134904157?
CID 134904157 has a molecular weight of 361.21 g/mol, XLogP of 3.99, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 134904157 is sourced from PubChem (CID 134904157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).