C13H18O3 — CID 13490448
(4,4-dimethyl-6-oxocyclohexen-1-yl)methyl (E)-but-2-enoate (PubChem CID 13490448) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (4,4-dimethyl-6-oxocyclohexen-1-yl)methyl (E)-but-2-enoate.
| Compound Name | (4,4-dimethyl-6-oxocyclohexen-1-yl)methyl (E)-but-2-enoate |
|---|---|
| PubChem CID | 13490448 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (4,4-dimethyl-6-oxocyclohexen-1-yl)methyl (E)-but-2-enoate |
| SMILES | C/C=C/C(=O)OCC1=CCC(C)(C)CC1=O |
| InChI | InChI=1S/C13H18O3/c1-4-5-12(15)16-9-10-6-7-13(2,3)8-11(10)14/h4-6H,7-9H2,1-3H3/b5-4+ |
| InChIKey | SBILYBYVAZOKLZ-SNAWJCMRSA-N |
| XLogP | 2.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|