C21H25NO2 — CID 134905259
(2S,5S)-2-(dibenzylamino)-5-hydroxyhept-6-en-3-one (PubChem CID 134905259) has the molecular formula C21H25NO2 and a molecular weight of 323.44 g/mol. Its IUPAC name is (2S,5S)-2-(dibenzylamino)-5-hydroxyhept-6-en-3-one.
| Compound Name | (2S,5S)-2-(dibenzylamino)-5-hydroxyhept-6-en-3-one |
|---|---|
| PubChem CID | 134905259 |
| Molecular Formula | C21H25NO2 |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.19 |
| IUPAC Name | (2S,5S)-2-(dibenzylamino)-5-hydroxyhept-6-en-3-one |
| SMILES | C=C[C@@H](O)CC(=O)[C@H](C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H25NO2/c1-3-20(23)14-21(24)17(2)22(15-18-10-6-4-7-11-18)16-19-12-8-5-9-13-19/h3-13,17,20,23H,1,14-16H2,2H3/t17-,20+/m0/s1 |
| InChIKey | VNZOQCNZTIZQFX-FXAWDEMLSA-N |
| XLogP | 3.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|