C17H28Li2OS2 — CID 134906348
dilithium;(Z,7Z)-7-[(E)-6-hydroxy-4-methylhex-4-enylidene]-3-methylnon-3-ene-1,9-dithiolate (PubChem CID 134906348) has the molecular formula C17H28Li2OS2 and a molecular weight of 326.43 g/mol. Its IUPAC name is dilithium;(Z,7Z)-7-[(E)-6-hydroxy-4-methylhex-4-enylidene]-3-methylnon-3-ene-1,9-dithiolate.
| Compound Name | dilithium;(Z,7Z)-7-[(E)-6-hydroxy-4-methylhex-4-enylidene]-3-methylnon-3-ene-1,9-dithiolate |
|---|---|
| PubChem CID | 134906348 |
| Molecular Formula | C17H28Li2OS2 |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | dilithium;(Z,7Z)-7-[(E)-6-hydroxy-4-methylhex-4-enylidene]-3-methylnon-3-ene-1,9-dithiolate |
| SMILES | C/C(=C/CC/C(=C/CC/C(C)=C/CO)CC[S-])CC[S-].[Li+].[Li+] |
| InChI | InChI=1S/C17H30OS2.2Li/c1-15(9-12-18)5-3-7-17(11-14-20)8-4-6-16(2)10-13-19;;/h6-7,9,18-20H,3-5,8,10-14H2,1-2H3;;/q;2*+1/p-2/b15-9+,16-6-,17-7-;; |
| InChIKey | ARXLHTZABCRDEI-JNNPUXBRSA-L |
| XLogP | -1.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|