C17H24O7 — CID 134907391
dimethyl 3-(2-methoxy-2-oxoethyl)-3a-methyl-4-oxo-2,3,5,6,7,7a-hexahydroindene-1,1-dicarboxylate (PubChem CID 134907391) has the molecular formula C17H24O7 and a molecular weight of 340.37 g/mol. Its IUPAC name is dimethyl 3-(2-methoxy-2-oxoethyl)-3a-methyl-4-oxo-2,3,5,6,7,7a-hexahydroindene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-(2-methoxy-2-oxoethyl)-3a-methyl-4-oxo-2,3,5,6,7,7a-hexahydroindene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 134907391 |
| Molecular Formula | C17H24O7 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | dimethyl 3-(2-methoxy-2-oxoethyl)-3a-methyl-4-oxo-2,3,5,6,7,7a-hexahydroindene-1,1-dicarboxylate |
| SMILES | COC(=O)CC1CC(C(=O)OC)(C(=O)OC)C2CCCC(=O)C12C |
| InChI | InChI=1S/C17H24O7/c1-16-10(8-13(19)22-2)9-17(14(20)23-3,15(21)24-4)11(16)6-5-7-12(16)18/h10-11H,5-9H2,1-4H3 |
| InChIKey | OMBZDQSNXVMVBH-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|