C22H29NO2 — CID 134907839
(2S,5S)-2-(dibenzylamino)-5-hydroxy-6-methylheptan-3-one (PubChem CID 134907839) has the molecular formula C22H29NO2 and a molecular weight of 339.48 g/mol. Its IUPAC name is (2S,5S)-2-(dibenzylamino)-5-hydroxy-6-methylheptan-3-one.
| Compound Name | (2S,5S)-2-(dibenzylamino)-5-hydroxy-6-methylheptan-3-one |
|---|---|
| PubChem CID | 134907839 |
| Molecular Formula | C22H29NO2 |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.22 |
| IUPAC Name | (2S,5S)-2-(dibenzylamino)-5-hydroxy-6-methylheptan-3-one |
| SMILES | CC(C)[C@@H](O)CC(=O)[C@H](C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H29NO2/c1-17(2)21(24)14-22(25)18(3)23(15-19-10-6-4-7-11-19)16-20-12-8-5-9-13-20/h4-13,17-18,21,24H,14-16H2,1-3H3/t18-,21-/m0/s1 |
| InChIKey | XKVAGSRGVLXFDR-RXVVDRJESA-N |
| XLogP | 4.05 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |