C10H8N2O3S2 — CID 134908218
4-methyl-5-(4-nitrophenyl)sulfanyl-3H-1,3-thiazol-2-one (PubChem CID 134908218) has the molecular formula C10H8N2O3S2 and a molecular weight of 268.32 g/mol. Its IUPAC name is 4-methyl-5-(4-nitrophenyl)sulfanyl-3H-1,3-thiazol-2-one.
| Compound Name | 4-methyl-5-(4-nitrophenyl)sulfanyl-3H-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 134908218 |
| Molecular Formula | C10H8N2O3S2 |
| Molecular Weight | 268.32 g/mol |
| Exact Mass | 268.00 |
| IUPAC Name | 4-methyl-5-(4-nitrophenyl)sulfanyl-3H-1,3-thiazol-2-one |
| SMILES | Cc1[nH]c(=O)sc1Sc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C10H8N2O3S2/c1-6-9(17-10(13)11-6)16-8-4-2-7(3-5-8)12(14)15/h2-5H,1H3,(H,11,13) |
| InChIKey | ZEUMAMSUKAFLRP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 76.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|