C16H12N2S2 — CID 134908390
2,6-diphenyl-1λ4,8-dithia-2,3-diazabicyclo[3.3.0]octa-1(5),3,6-triene (PubChem CID 134908390) has the molecular formula C16H12N2S2 and a molecular weight of 296.42 g/mol. Its IUPAC name is 2,6-diphenyl-1λ4,8-dithia-2,3-diazabicyclo[3.3.0]octa-1(5),3,6-triene.
| Compound Name | 2,6-diphenyl-1λ4,8-dithia-2,3-diazabicyclo[3.3.0]octa-1(5),3,6-triene |
|---|---|
| PubChem CID | 134908390 |
| Molecular Formula | C16H12N2S2 |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.04 |
| IUPAC Name | 2,6-diphenyl-1λ4,8-dithia-2,3-diazabicyclo[3.3.0]octa-1(5),3,6-triene |
| SMILES | C1=NN(c2ccccc2)S2=C1C(c1ccccc1)=CS2 |
| InChI | InChI=1S/C16H12N2S2/c1-3-7-13(8-4-1)15-12-19-20-16(15)11-17-18(20)14-9-5-2-6-10-14/h1-12H |
| InChIKey | ACHKMBXVCIYGKU-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|