C16H14N4S — CID 15169184
2-methyl-4,8-diphenyl-1lambda4-thia-2,3,7,8-tetrazabicyclo[3.3.0]octa-1(5),3,6-triene (PubChem CID 15169184) has the molecular formula C16H14N4S and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-methyl-4,8-diphenyl-1lambda4-thia-2,3,7,8-tetrazabicyclo[3.3.0]octa-1(5),3,6-triene.
| Compound Name | 2-methyl-4,8-diphenyl-1lambda4-thia-2,3,7,8-tetrazabicyclo[3.3.0]octa-1(5),3,6-triene |
|---|---|
| PubChem CID | 15169184 |
| Molecular Formula | C16H14N4S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 2-methyl-4,8-diphenyl-1lambda4-thia-2,3,7,8-tetrazabicyclo[3.3.0]octa-1(5),3,6-triene |
| SMILES | CN1N=C(c2ccccc2)C2=S1N(c1ccccc1)N=C2 |
| InChI | InChI=1S/C16H14N4S/c1-19-18-16(13-8-4-2-5-9-13)15-12-17-20(21(15)19)14-10-6-3-7-11-14/h2-12H,1H3 |
| InChIKey | FPZHGDKKAZGGPD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 31.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|