C22H16N2S2 — CID 134908521
2,4,6-triphenyl-1λ4,8-dithia-2,3-diazabicyclo[3.3.0]octa-1(5),3,6-triene (PubChem CID 134908521) has the molecular formula C22H16N2S2 and a molecular weight of 372.52 g/mol. Its IUPAC name is 2,4,6-triphenyl-1λ4,8-dithia-2,3-diazabicyclo[3.3.0]octa-1(5),3,6-triene.
| Compound Name | 2,4,6-triphenyl-1λ4,8-dithia-2,3-diazabicyclo[3.3.0]octa-1(5),3,6-triene |
|---|---|
| PubChem CID | 134908521 |
| Molecular Formula | C22H16N2S2 |
| Molecular Weight | 372.52 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 2,4,6-triphenyl-1λ4,8-dithia-2,3-diazabicyclo[3.3.0]octa-1(5),3,6-triene |
| SMILES | C1=C(c2ccccc2)C2=S(S1)N(c1ccccc1)N=C2c1ccccc1 |
| InChI | InChI=1S/C22H16N2S2/c1-4-10-17(11-5-1)20-16-25-26-22(20)21(18-12-6-2-7-13-18)23-24(26)19-14-8-3-9-15-19/h1-16H |
| InChIKey | NPQYQLQBTQQZHI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.52 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|