About 2-(trifluoromethyl)phenanthro[9,10-b]pyran-4-one
2-(trifluoromethyl)phenanthro[9,10-b]pyran-4-one (PubChem CID 134910497) has the molecular formula C18H9F3O2
and a molecular weight of 314.26 g/mol. Its IUPAC name is 2-(trifluoromethyl)phenanthro[9,10-b]pyran-4-one.
Molecular Properties
| Compound Name | 2-(trifluoromethyl)phenanthro[9,10-b]pyran-4-one |
| PubChem CID | 134910497 |
| Molecular Formula | C18H9F3O2 |
| Molecular Weight | 314.26 g/mol |
| Exact Mass | 314.06 |
| IUPAC Name | 2-(trifluoromethyl)phenanthro[9,10-b]pyran-4-one |
| SMILES | O=c1cc(C(F)(F)F)oc2c3ccccc3c3ccccc3c12 |
| InChI | InChI=1S/C18H9F3O2/c19-18(20,21)15-9-14(22)16-12-7-3-1-5-10(12)11-6-2-4-8-13(11)17(16)23-15/h1-9H |
| InChIKey | IFUUCIWQEXJOHT-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.26 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(trifluoromethyl)phenanthro[9,10-b]pyran-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(trifluoromethyl)phenanthro[9,10-b]pyran-4-one?
The IUPAC name of 2-(trifluoromethyl)phenanthro[9,10-b]pyran-4-one (CID 134910497) is 2-(trifluoromethyl)phenanthro[9,10-b]pyran-4-one.
What is the SMILES notation for 2-(trifluoromethyl)phenanthro[9,10-b]pyran-4-one?
The canonical SMILES for 2-(trifluoromethyl)phenanthro[9,10-b]pyran-4-one is O=c1cc(C(F)(F)F)oc2c3ccccc3c3ccccc3c12.
What is the InChIKey of 2-(trifluoromethyl)phenanthro[9,10-b]pyran-4-one?
The InChIKey is IFUUCIWQEXJOHT-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H9F3O2/c19-18(20,21)15-9-14(22)16-12-7-3-1-5-10(12)11-6-2-4-8-13(11)17(16)23-15/h1-9H.
What are the key properties of 2-(trifluoromethyl)phenanthro[9,10-b]pyran-4-one?
2-(trifluoromethyl)phenanthro[9,10-b]pyran-4-one has a molecular weight of 314.26 g/mol, XLogP of 5.12, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(trifluoromethyl)phenanthro[9,10-b]pyran-4-one is sourced from PubChem (CID 134910497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).